C7H10N2O2S — CID 130693463
2-hydroxy-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 130693463) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-hydroxy-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide.
| Compound Name | 2-hydroxy-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 130693463 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-hydroxy-N-[1-(1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)CO)c1nccs1 |
| InChI | InChI=1S/C7H10N2O2S/c1-5(9-6(11)4-10)7-8-2-3-12-7/h2-3,5,10H,4H2,1H3,(H,9,11) |
| InChIKey | ZMTSTWUFTFHXDZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |