C9H12N2O2S — CID 103253582
2-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]prop-2-enoic acid (PubChem CID 103253582) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103253582 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNC(C)c1nccs1)C(=O)O |
| InChI | InChI=1S/C9H12N2O2S/c1-6(9(12)13)5-11-7(2)8-10-3-4-14-8/h3-4,7,11H,1,5H2,2H3,(H,12,13) |
| InChIKey | MCISBLBMQFOLAP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|