C8H14N2O2S — CID 66174830
3-[1-(1,3-thiazol-2-yl)ethylamino]propane-1,2-diol (PubChem CID 66174830) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 3-[1-(1,3-thiazol-2-yl)ethylamino]propane-1,2-diol.
| Compound Name | 3-[1-(1,3-thiazol-2-yl)ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 66174830 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 3-[1-(1,3-thiazol-2-yl)ethylamino]propane-1,2-diol |
| SMILES | CC(NCC(O)CO)c1nccs1 |
| InChI | InChI=1S/C8H14N2O2S/c1-6(8-9-2-3-13-8)10-4-7(12)5-11/h2-3,6-7,10-12H,4-5H2,1H3 |
| InChIKey | BAXCLQGRCQBIDO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |