C8H14N4OS — CID 103253585
2-amino-3-[1-(1,3-thiazol-2-yl)ethylamino]propanamide (PubChem CID 103253585) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-amino-3-[1-(1,3-thiazol-2-yl)ethylamino]propanamide.
| Compound Name | 2-amino-3-[1-(1,3-thiazol-2-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 103253585 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-amino-3-[1-(1,3-thiazol-2-yl)ethylamino]propanamide |
| SMILES | CC(NCC(N)C(N)=O)c1nccs1 |
| InChI | InChI=1S/C8H14N4OS/c1-5(8-11-2-3-14-8)12-4-6(9)7(10)13/h2-3,5-6,12H,4,9H2,1H3,(H2,10,13) |
| InChIKey | ZFZHCXHYEBXCPL-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |