C8H13N3O2S — CID 106171868
2-hydroxy-3-[1-(1,3-thiazol-2-yl)ethylamino]propanamide (PubChem CID 106171868) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-hydroxy-3-[1-(1,3-thiazol-2-yl)ethylamino]propanamide.
| Compound Name | 2-hydroxy-3-[1-(1,3-thiazol-2-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 106171868 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-hydroxy-3-[1-(1,3-thiazol-2-yl)ethylamino]propanamide |
| SMILES | CC(NCC(O)C(N)=O)c1nccs1 |
| InChI | InChI=1S/C8H13N3O2S/c1-5(8-10-2-3-14-8)11-4-6(12)7(9)13/h2-3,5-6,11-12H,4H2,1H3,(H2,9,13) |
| InChIKey | UVFSNEKKSYVVGZ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |