C14H18N2OS — CID 112742116
(1R)-1-phenyl-3-[1-(1,3-thiazol-2-yl)ethylamino]propan-1-ol (PubChem CID 112742116) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is (1R)-1-phenyl-3-[1-(1,3-thiazol-2-yl)ethylamino]propan-1-ol.
| Compound Name | (1R)-1-phenyl-3-[1-(1,3-thiazol-2-yl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 112742116 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (1R)-1-phenyl-3-[1-(1,3-thiazol-2-yl)ethylamino]propan-1-ol |
| SMILES | CC(NCC[C@@H](O)c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C14H18N2OS/c1-11(14-16-9-10-18-14)15-8-7-13(17)12-5-3-2-4-6-12/h2-6,9-11,13,15,17H,7-8H2,1H3/t11?,13-/m1/s1 |
| InChIKey | AWPLHBFSDAOFFZ-GLGOKHISSA-N |
| XLogP | 2.92 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |