C10H9NOS — CID 10511917
(R)-phenyl(1,3-thiazol-2-yl)methanol (PubChem CID 10511917) has the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. Its IUPAC name is (R)-phenyl(1,3-thiazol-2-yl)methanol.
| Compound Name | (R)-phenyl(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 10511917 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | (R)-phenyl(1,3-thiazol-2-yl)methanol |
| SMILES | O[C@H](c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C10H9NOS/c12-9(10-11-6-7-13-10)8-4-2-1-3-5-8/h1-7,9,12H/t9-/m1/s1 |
| InChIKey | XHPLEXYGTGYCCO-SECBINFHSA-N |
| XLogP | 2.22 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |