C13H13NO2S — CID 114518732
(4-cyclopropyloxyphenyl)-(1,3-thiazol-2-yl)methanol (PubChem CID 114518732) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is (4-cyclopropyloxyphenyl)-(1,3-thiazol-2-yl)methanol.
| Compound Name | (4-cyclopropyloxyphenyl)-(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 114518732 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | (4-cyclopropyloxyphenyl)-(1,3-thiazol-2-yl)methanol |
| SMILES | OC(c1ccc(OC2CC2)cc1)c1nccs1 |
| InChI | InChI=1S/C13H13NO2S/c15-12(13-14-7-8-17-13)9-1-3-10(4-2-9)16-11-5-6-11/h1-4,7-8,11-12,15H,5-6H2 |
| InChIKey | PCGHECXTZZOUPO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |