C14H15NOS — CID 114601615
(3-cyclobutylphenyl)-(1,3-thiazol-2-yl)methanol (PubChem CID 114601615) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is (3-cyclobutylphenyl)-(1,3-thiazol-2-yl)methanol.
| Compound Name | (3-cyclobutylphenyl)-(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 114601615 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (3-cyclobutylphenyl)-(1,3-thiazol-2-yl)methanol |
| SMILES | OC(c1cccc(C2CCC2)c1)c1nccs1 |
| InChI | InChI=1S/C14H15NOS/c16-13(14-15-7-8-17-14)12-6-2-5-11(9-12)10-3-1-4-10/h2,5-10,13,16H,1,3-4H2 |
| InChIKey | OPHUKCJECYFQIQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |