C12H17NO2S — CID 142101108
ethane;phenyl(1,3-thiazol-2-yl)methanol;hydrate (PubChem CID 142101108) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is ethane;phenyl(1,3-thiazol-2-yl)methanol;hydrate.
| Compound Name | ethane;phenyl(1,3-thiazol-2-yl)methanol;hydrate |
|---|---|
| PubChem CID | 142101108 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | ethane;phenyl(1,3-thiazol-2-yl)methanol;hydrate |
| SMILES | CC.O.OC(c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C10H9NOS.C2H6.H2O/c12-9(10-11-6-7-13-10)8-4-2-1-3-5-8;1-2;/h1-7,9,12H;1-2H3;1H2 |
| InChIKey | LZQSUQWRHCGNDR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |