C10H9FN2OS — CID 118355623
(3-amino-4-fluorophenyl)-(1,3-thiazol-2-yl)methanol (PubChem CID 118355623) has the molecular formula C10H9FN2OS and a molecular weight of 224.26 g/mol. Its IUPAC name is (3-amino-4-fluorophenyl)-(1,3-thiazol-2-yl)methanol.
| Compound Name | (3-amino-4-fluorophenyl)-(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 118355623 |
| Molecular Formula | C10H9FN2OS |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (3-amino-4-fluorophenyl)-(1,3-thiazol-2-yl)methanol |
| SMILES | Nc1cc(C(O)c2nccs2)ccc1F |
| InChI | InChI=1S/C10H9FN2OS/c11-7-2-1-6(5-8(7)12)9(14)10-13-3-4-15-10/h1-5,9,14H,12H2 |
| InChIKey | NDDQHKSGRNHFAH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|