C7H6N2OS2 — CID 131172938
1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol (PubChem CID 131172938) has the molecular formula C7H6N2OS2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol.
| Compound Name | 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 131172938 |
| Molecular Formula | C7H6N2OS2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol |
| SMILES | OC(c1ccns1)c1nccs1 |
| InChI | InChI=1S/C7H6N2OS2/c10-6(5-1-2-9-12-5)7-8-3-4-11-7/h1-4,6,10H |
| InChIKey | CTQZKFXQCSEGAE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |