About 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol
1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol (PubChem CID 131172938) has the molecular formula C7H6N2OS2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol |
| PubChem CID | 131172938 |
| Molecular Formula | C7H6N2OS2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol |
| SMILES | OC(c1ccns1)c1nccs1 |
| InChI | InChI=1S/C7H6N2OS2/c10-6(5-1-2-9-12-5)7-8-3-4-11-7/h1-4,6,10H |
| InChIKey | CTQZKFXQCSEGAE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol?
The IUPAC name of 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol (CID 131172938) is 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol.
What is the SMILES notation for 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol?
The canonical SMILES for 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol is OC(c1ccns1)c1nccs1.
What is the InChIKey of 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol?
The InChIKey is CTQZKFXQCSEGAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS2/c10-6(5-1-2-9-12-5)7-8-3-4-11-7/h1-4,6,10H.
What are the key properties of 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol?
1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol has a molecular weight of 198.27 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-thiazol-5-yl(1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 131172938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).