About (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol
(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol (PubChem CID 119087694) has the molecular formula C10H8ClNOS
and a molecular weight of 225.70 g/mol. Its IUPAC name is (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol |
| PubChem CID | 119087694 |
| Molecular Formula | C10H8ClNOS |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol |
| SMILES | OC(c1ccc(Cl)cc1)c1ccns1 |
| InChI | InChI=1S/C10H8ClNOS/c11-8-3-1-7(2-4-8)10(13)9-5-6-12-14-9/h1-6,10,13H |
| InChIKey | SSDXGTLTLHTSAE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol?
The IUPAC name of (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol (CID 119087694) is (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol.
What is the SMILES notation for (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol?
The canonical SMILES for (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol is OC(c1ccc(Cl)cc1)c1ccns1.
What is the InChIKey of (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol?
The InChIKey is SSDXGTLTLHTSAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNOS/c11-8-3-1-7(2-4-8)10(13)9-5-6-12-14-9/h1-6,10,13H.
What are the key properties of (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol?
(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol has a molecular weight of 225.70 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-(1,2-thiazol-5-yl)methanol is sourced from PubChem (CID 119087694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).