About pyrazin-2-yl(1,2-thiazol-5-yl)methanol
pyrazin-2-yl(1,2-thiazol-5-yl)methanol (PubChem CID 131172108) has the molecular formula C8H7N3OS
and a molecular weight of 193.23 g/mol. Its IUPAC name is pyrazin-2-yl(1,2-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | pyrazin-2-yl(1,2-thiazol-5-yl)methanol |
| PubChem CID | 131172108 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | pyrazin-2-yl(1,2-thiazol-5-yl)methanol |
| SMILES | OC(c1cnccn1)c1ccns1 |
| InChI | InChI=1S/C8H7N3OS/c12-8(7-1-2-11-13-7)6-5-9-3-4-10-6/h1-5,8,12H |
| InChIKey | NVZDFDXOSDMJDP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyrazin-2-yl(1,2-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazin-2-yl(1,2-thiazol-5-yl)methanol?
The IUPAC name of pyrazin-2-yl(1,2-thiazol-5-yl)methanol (CID 131172108) is pyrazin-2-yl(1,2-thiazol-5-yl)methanol.
What is the SMILES notation for pyrazin-2-yl(1,2-thiazol-5-yl)methanol?
The canonical SMILES for pyrazin-2-yl(1,2-thiazol-5-yl)methanol is OC(c1cnccn1)c1ccns1.
What is the InChIKey of pyrazin-2-yl(1,2-thiazol-5-yl)methanol?
The InChIKey is NVZDFDXOSDMJDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3OS/c12-8(7-1-2-11-13-7)6-5-9-3-4-10-6/h1-5,8,12H.
What are the key properties of pyrazin-2-yl(1,2-thiazol-5-yl)methanol?
pyrazin-2-yl(1,2-thiazol-5-yl)methanol has a molecular weight of 193.23 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazin-2-yl(1,2-thiazol-5-yl)methanol is sourced from PubChem (CID 131172108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).