C9H9N3OS — CID 131036675
(5-methylpyrazin-2-yl)-(1,2-thiazol-5-yl)methanol (PubChem CID 131036675) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is (5-methylpyrazin-2-yl)-(1,2-thiazol-5-yl)methanol.
| Compound Name | (5-methylpyrazin-2-yl)-(1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 131036675 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (5-methylpyrazin-2-yl)-(1,2-thiazol-5-yl)methanol |
| SMILES | Cc1cnc(C(O)c2ccns2)cn1 |
| InChI | InChI=1S/C9H9N3OS/c1-6-4-11-7(5-10-6)9(13)8-2-3-12-14-8/h2-5,9,13H,1H3 |
| InChIKey | DEKDIPMYTKIJKF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |