C11H14N2O2 — CID 105124479
3,4-dihydro-2H-pyran-5-yl-(5-methylpyrazin-2-yl)methanol (PubChem CID 105124479) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-5-yl-(5-methylpyrazin-2-yl)methanol.
| Compound Name | 3,4-dihydro-2H-pyran-5-yl-(5-methylpyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 105124479 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3,4-dihydro-2H-pyran-5-yl-(5-methylpyrazin-2-yl)methanol |
| SMILES | Cc1cnc(C(O)C2=COCCC2)cn1 |
| InChI | InChI=1S/C11H14N2O2/c1-8-5-13-10(6-12-8)11(14)9-3-2-4-15-7-9/h5-7,11,14H,2-4H2,1H3 |
| InChIKey | LEGJMDCGUMNNJG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |