C14H14N2O2 — CID 105124475
3,4-dihydro-2H-pyran-5-yl(quinoxalin-5-yl)methanol (PubChem CID 105124475) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-5-yl(quinoxalin-5-yl)methanol.
| Compound Name | 3,4-dihydro-2H-pyran-5-yl(quinoxalin-5-yl)methanol |
|---|---|
| PubChem CID | 105124475 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3,4-dihydro-2H-pyran-5-yl(quinoxalin-5-yl)methanol |
| SMILES | OC(C1=COCCC1)c1cccc2nccnc12 |
| InChI | InChI=1S/C14H14N2O2/c17-14(10-3-2-8-18-9-10)11-4-1-5-12-13(11)16-7-6-15-12/h1,4-7,9,14,17H,2-3,8H2 |
| InChIKey | CFLZVDYBMABJQF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |