C10H11ClO3 — CID 106693982
(5-chlorofuran-2-yl)-(3,4-dihydro-2H-pyran-5-yl)methanol (PubChem CID 106693982) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-(3,4-dihydro-2H-pyran-5-yl)methanol.
| Compound Name | (5-chlorofuran-2-yl)-(3,4-dihydro-2H-pyran-5-yl)methanol |
|---|---|
| PubChem CID | 106693982 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | (5-chlorofuran-2-yl)-(3,4-dihydro-2H-pyran-5-yl)methanol |
| SMILES | OC(C1=COCCC1)c1ccc(Cl)o1 |
| InChI | InChI=1S/C10H11ClO3/c11-9-4-3-8(14-9)10(12)7-2-1-5-13-6-7/h3-4,6,10,12H,1-2,5H2 |
| InChIKey | JKBBHNCDWOSYDS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |