C16H19ClO2 — CID 106688821
(5-chlorofuran-2-yl)-(2,3,4,5,6-pentamethylphenyl)methanol (PubChem CID 106688821) has the molecular formula C16H19ClO2 and a molecular weight of 278.78 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-(2,3,4,5,6-pentamethylphenyl)methanol.
| Compound Name | (5-chlorofuran-2-yl)-(2,3,4,5,6-pentamethylphenyl)methanol |
|---|---|
| PubChem CID | 106688821 |
| Molecular Formula | C16H19ClO2 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (5-chlorofuran-2-yl)-(2,3,4,5,6-pentamethylphenyl)methanol |
| SMILES | Cc1c(C)c(C)c(C(O)c2ccc(Cl)o2)c(C)c1C |
| InChI | InChI=1S/C16H19ClO2/c1-8-9(2)11(4)15(12(5)10(8)3)16(18)13-6-7-14(17)19-13/h6-7,16,18H,1-5H3 |
| InChIKey | HLNORZDPRKBMNC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |