C10H7ClO5 — CID 106947249
5-[(5-chlorofuran-2-yl)-hydroxymethyl]furan-2-carboxylic acid (PubChem CID 106947249) has the molecular formula C10H7ClO5 and a molecular weight of 242.61 g/mol. Its IUPAC name is 5-[(5-chlorofuran-2-yl)-hydroxymethyl]furan-2-carboxylic acid.
| Compound Name | 5-[(5-chlorofuran-2-yl)-hydroxymethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106947249 |
| Molecular Formula | C10H7ClO5 |
| Molecular Weight | 242.61 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 5-[(5-chlorofuran-2-yl)-hydroxymethyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(O)c2ccc(Cl)o2)o1 |
| InChI | InChI=1S/C10H7ClO5/c11-8-4-3-6(16-8)9(12)5-1-2-7(15-5)10(13)14/h1-4,9,12H,(H,13,14) |
| InChIKey | WVLZQBCYQCOIOI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.61 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |