C8H8O7 — CID 170823605
5-(2-carboxy-1,2-dihydroxyethyl)furan-2-carboxylic acid (PubChem CID 170823605) has the molecular formula C8H8O7 and a molecular weight of 216.14 g/mol. Its IUPAC name is 5-(2-carboxy-1,2-dihydroxyethyl)furan-2-carboxylic acid.
| Compound Name | 5-(2-carboxy-1,2-dihydroxyethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 170823605 |
| Molecular Formula | C8H8O7 |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 5-(2-carboxy-1,2-dihydroxyethyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(O)C(O)C(=O)O)o1 |
| InChI | InChI=1S/C8H8O7/c9-5(6(10)8(13)14)3-1-2-4(15-3)7(11)12/h1-2,5-6,9-10H,(H,11,12)(H,13,14) |
| InChIKey | GFSVGIJSWXPWDX-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |