C9H12O5 — CID 106947351
5-(1-hydroxy-3-methoxypropyl)furan-2-carboxylic acid (PubChem CID 106947351) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is 5-(1-hydroxy-3-methoxypropyl)furan-2-carboxylic acid.
| Compound Name | 5-(1-hydroxy-3-methoxypropyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106947351 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 5-(1-hydroxy-3-methoxypropyl)furan-2-carboxylic acid |
| SMILES | COCCC(O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C9H12O5/c1-13-5-4-6(10)7-2-3-8(14-7)9(11)12/h2-3,6,10H,4-5H2,1H3,(H,11,12) |
| InChIKey | VIZCBQQCURUIBF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |