C11H16O5 — CID 79083530
5-[1-(3-methoxypropoxy)ethyl]furan-2-carboxylic acid (PubChem CID 79083530) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is 5-[1-(3-methoxypropoxy)ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-(3-methoxypropoxy)ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 79083530 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-[1-(3-methoxypropoxy)ethyl]furan-2-carboxylic acid |
| SMILES | COCCCOC(C)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C11H16O5/c1-8(15-7-3-6-14-2)9-4-5-10(16-9)11(12)13/h4-5,8H,3,6-7H2,1-2H3,(H,12,13) |
| InChIKey | ZEOANYKQGQTAIM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|