C12H18O6 — CID 113426720
5-[1-[2-(2-methoxyethoxy)ethoxy]ethyl]furan-2-carboxylic acid (PubChem CID 113426720) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is 5-[1-[2-(2-methoxyethoxy)ethoxy]ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-[2-(2-methoxyethoxy)ethoxy]ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 113426720 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 5-[1-[2-(2-methoxyethoxy)ethoxy]ethyl]furan-2-carboxylic acid |
| SMILES | COCCOCCOC(C)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C12H18O6/c1-9(17-8-7-16-6-5-15-2)10-3-4-11(18-10)12(13)14/h3-4,9H,5-8H2,1-2H3,(H,13,14) |
| InChIKey | MZZOCHVGOKXHJY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|