C8H10O6S — CID 63943954
5-(2-methoxyethylsulfonyl)furan-2-carboxylic acid (PubChem CID 63943954) has the molecular formula C8H10O6S and a molecular weight of 234.23 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfonyl)furan-2-carboxylic acid.
| Compound Name | 5-(2-methoxyethylsulfonyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63943954 |
| Molecular Formula | C8H10O6S |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 5-(2-methoxyethylsulfonyl)furan-2-carboxylic acid |
| SMILES | COCCS(=O)(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C8H10O6S/c1-13-4-5-15(11,12)7-3-2-6(14-7)8(9)10/h2-3H,4-5H2,1H3,(H,9,10) |
| InChIKey | AFWBNHDBLRWGAS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |