About 5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid
5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid (PubChem CID 170903953) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid.
Analyze 5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid?
The IUPAC name of 5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid (CID 170903953) is 5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid is CC(C)(C)[C@H](O)c1ccc(C(=O)O)o1.
What is the InChIKey of 5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid?
The InChIKey is YYZRFDJENREARO-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H14O4/c1-10(2,3)8(11)6-4-5-7(14-6)9(12)13/h4-5,8,11H,1-3H3,(H,12,13)/t8-/m1/s1.
What are the key properties of 5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid?
5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid has a molecular weight of 198.22 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S)-1-hydroxy-2,2-dimethylpropyl]furan-2-carboxylic acid is sourced from PubChem (CID 170903953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).