C16H18O4 — CID 106947428
5-[(2-tert-butylphenyl)-hydroxymethyl]furan-2-carboxylic acid (PubChem CID 106947428) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-[(2-tert-butylphenyl)-hydroxymethyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2-tert-butylphenyl)-hydroxymethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106947428 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 5-[(2-tert-butylphenyl)-hydroxymethyl]furan-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccccc1C(O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C16H18O4/c1-16(2,3)11-7-5-4-6-10(11)14(17)12-8-9-13(20-12)15(18)19/h4-9,14,17H,1-3H3,(H,18,19) |
| InChIKey | NKIRVRVUUIWXBK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |