C13H12O6S — CID 106947214
5-[hydroxy-(4-methylsulfonylphenyl)methyl]furan-2-carboxylic acid (PubChem CID 106947214) has the molecular formula C13H12O6S and a molecular weight of 296.30 g/mol. Its IUPAC name is 5-[hydroxy-(4-methylsulfonylphenyl)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[hydroxy-(4-methylsulfonylphenyl)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106947214 |
| Molecular Formula | C13H12O6S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 5-[hydroxy-(4-methylsulfonylphenyl)methyl]furan-2-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(C(O)c2ccc(C(=O)O)o2)cc1 |
| InChI | InChI=1S/C13H12O6S/c1-20(17,18)9-4-2-8(3-5-9)12(14)10-6-7-11(19-10)13(15)16/h2-7,12,14H,1H3,(H,15,16) |
| InChIKey | DDXCADZOQPTPDP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |