C15H18O2 — CID 113370484
(4-cyclopropylphenyl)-(3,4-dihydro-2H-pyran-5-yl)methanol (PubChem CID 113370484) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (4-cyclopropylphenyl)-(3,4-dihydro-2H-pyran-5-yl)methanol.
| Compound Name | (4-cyclopropylphenyl)-(3,4-dihydro-2H-pyran-5-yl)methanol |
|---|---|
| PubChem CID | 113370484 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (4-cyclopropylphenyl)-(3,4-dihydro-2H-pyran-5-yl)methanol |
| SMILES | OC(C1=COCCC1)c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C15H18O2/c16-15(14-2-1-9-17-10-14)13-7-5-12(6-8-13)11-3-4-11/h5-8,10-11,15-16H,1-4,9H2 |
| InChIKey | REBHLTQKMRJCJI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |