C12H15NO3 — CID 105124451
3,4-dihydro-2H-pyran-5-yl-(2-methoxy-3-pyridinyl)methanol (PubChem CID 105124451) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-5-yl-(2-methoxy-3-pyridinyl)methanol.
| Compound Name | 3,4-dihydro-2H-pyran-5-yl-(2-methoxy-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 105124451 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 3,4-dihydro-2H-pyran-5-yl-(2-methoxy-3-pyridinyl)methanol |
| SMILES | COc1ncccc1C(O)C1=COCCC1 |
| InChI | InChI=1S/C12H15NO3/c1-15-12-10(5-2-6-13-12)11(14)9-4-3-7-16-8-9/h2,5-6,8,11,14H,3-4,7H2,1H3 |
| InChIKey | IVAHJNGGVIEIAX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |