C4H6N2OS2 — CID 143542329
hydroxysulfanyl(1,3-thiazol-2-yl)methanamine (PubChem CID 143542329) has the molecular formula C4H6N2OS2 and a molecular weight of 162.24 g/mol. Its IUPAC name is hydroxysulfanyl(1,3-thiazol-2-yl)methanamine.
| Compound Name | hydroxysulfanyl(1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 143542329 |
| Molecular Formula | C4H6N2OS2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 161.99 |
| IUPAC Name | hydroxysulfanyl(1,3-thiazol-2-yl)methanamine |
| SMILES | NC(SO)c1nccs1 |
| InChI | InChI=1S/C4H6N2OS2/c5-3(9-7)4-6-1-2-8-4/h1-3,7H,5H2 |
| InChIKey | PYJJXDNVIGUUBA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|