C5H8N2OS — CID 83004028
(1S)-2-amino-1-(1,3-thiazol-2-yl)ethanol (PubChem CID 83004028) has the molecular formula C5H8N2OS and a molecular weight of 144.20 g/mol. Its IUPAC name is (1S)-2-amino-1-(1,3-thiazol-2-yl)ethanol.
| Compound Name | (1S)-2-amino-1-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 83004028 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (1S)-2-amino-1-(1,3-thiazol-2-yl)ethanol |
| SMILES | NC[C@H](O)c1nccs1 |
| InChI | InChI=1S/C5H8N2OS/c6-3-4(8)5-7-1-2-9-5/h1-2,4,8H,3,6H2/t4-/m0/s1 |
| InChIKey | YITMIMFEDYPHGH-BYPYZUCNSA-N |
| XLogP | 0.14 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |