C7H11NO3S — CID 171871689
1-(1,3-thiazol-2-yl)butane-1,2,4-triol (PubChem CID 171871689) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)butane-1,2,4-triol.
| Compound Name | 1-(1,3-thiazol-2-yl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171871689 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1nccs1 |
| InChI | InChI=1S/C7H11NO3S/c9-3-1-5(10)6(11)7-8-2-4-12-7/h2,4-6,9-11H,1,3H2 |
| InChIKey | NSYKOUBAHVNDNF-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |