C7H12N2O2S — CID 10607650
(1S,2S,3R)-2-amino-1-(1,3-thiazol-2-yl)butane-1,3-diol (PubChem CID 10607650) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is (1S,2S,3R)-2-amino-1-(1,3-thiazol-2-yl)butane-1,3-diol.
| Compound Name | (1S,2S,3R)-2-amino-1-(1,3-thiazol-2-yl)butane-1,3-diol |
|---|---|
| PubChem CID | 10607650 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (1S,2S,3R)-2-amino-1-(1,3-thiazol-2-yl)butane-1,3-diol |
| SMILES | C[C@@H](O)[C@H](N)[C@H](O)c1nccs1 |
| InChI | InChI=1S/C7H12N2O2S/c1-4(10)5(8)6(11)7-9-2-3-12-7/h2-6,10-11H,8H2,1H3/t4-,5+,6+/m1/s1 |
| InChIKey | BVGCZQXGCDFVDR-SRQIZXRXSA-N |
| XLogP | -0.12 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |