C12H12N4OS2 — CID 57057171
2-(3-methylimidazol-4-yl)-1,2-bis(1,3-thiazol-2-yl)ethanol (PubChem CID 57057171) has the molecular formula C12H12N4OS2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-(3-methylimidazol-4-yl)-1,2-bis(1,3-thiazol-2-yl)ethanol.
| Compound Name | 2-(3-methylimidazol-4-yl)-1,2-bis(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 57057171 |
| Molecular Formula | C12H12N4OS2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-(3-methylimidazol-4-yl)-1,2-bis(1,3-thiazol-2-yl)ethanol |
| SMILES | Cn1cncc1C(c1nccs1)C(O)c1nccs1 |
| InChI | InChI=1S/C12H12N4OS2/c1-16-7-13-6-8(16)9(11-14-2-4-18-11)10(17)12-15-3-5-19-12/h2-7,9-10,17H,1H3 |
| InChIKey | IDBFVPJUMYFKKK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |