C9H12N4S — CID 66134319
(3-ethylimidazol-4-yl)-(1,3-thiazol-2-yl)methanamine (PubChem CID 66134319) has the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. Its IUPAC name is (3-ethylimidazol-4-yl)-(1,3-thiazol-2-yl)methanamine.
| Compound Name | (3-ethylimidazol-4-yl)-(1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 66134319 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (3-ethylimidazol-4-yl)-(1,3-thiazol-2-yl)methanamine |
| SMILES | CCn1cncc1C(N)c1nccs1 |
| InChI | InChI=1S/C9H12N4S/c1-2-13-6-11-5-7(13)8(10)9-12-3-4-14-9/h3-6,8H,2,10H2,1H3 |
| InChIKey | VGCLPBVCXCNNIL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |