C8H9N3OS — CID 130508756
(1-methylimidazol-4-yl)-(1,3-thiazol-2-yl)methanol (PubChem CID 130508756) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is (1-methylimidazol-4-yl)-(1,3-thiazol-2-yl)methanol.
| Compound Name | (1-methylimidazol-4-yl)-(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 130508756 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (1-methylimidazol-4-yl)-(1,3-thiazol-2-yl)methanol |
| SMILES | Cn1cnc(C(O)c2nccs2)c1 |
| InChI | InChI=1S/C8H9N3OS/c1-11-4-6(10-5-11)7(12)8-9-2-3-13-8/h2-5,7,12H,1H3 |
| InChIKey | UYFMOADOQGIFOW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |