C6H7F3N2O — CID 130508957
(1R)-2,2,2-trifluoro-1-(1-methylimidazol-4-yl)ethanol (PubChem CID 130508957) has the molecular formula C6H7F3N2O and a molecular weight of 180.13 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(1-methylimidazol-4-yl)ethanol.
| Compound Name | (1R)-2,2,2-trifluoro-1-(1-methylimidazol-4-yl)ethanol |
|---|---|
| PubChem CID | 130508957 |
| Molecular Formula | C6H7F3N2O |
| Molecular Weight | 180.13 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(1-methylimidazol-4-yl)ethanol |
| SMILES | Cn1cnc([C@@H](O)C(F)(F)F)c1 |
| InChI | InChI=1S/C6H7F3N2O/c1-11-2-4(10-3-11)5(12)6(7,8)9/h2-3,5,12H,1H3/t5-/m1/s1 |
| InChIKey | YILZHLYGQYYMQM-RXMQYKEDSA-N |
| XLogP | 1.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.13 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |