C5H6F3N3O — CID 130602732
(1R)-2,2,2-trifluoro-1-(1-methyltriazol-4-yl)ethanol (PubChem CID 130602732) has the molecular formula C5H6F3N3O and a molecular weight of 181.12 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(1-methyltriazol-4-yl)ethanol.
| Compound Name | (1R)-2,2,2-trifluoro-1-(1-methyltriazol-4-yl)ethanol |
|---|---|
| PubChem CID | 130602732 |
| Molecular Formula | C5H6F3N3O |
| Molecular Weight | 181.12 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(1-methyltriazol-4-yl)ethanol |
| SMILES | Cn1cc([C@@H](O)C(F)(F)F)nn1 |
| InChI | InChI=1S/C5H6F3N3O/c1-11-2-3(9-10-11)4(12)5(6,7)8/h2,4,12H,1H3/t4-/m1/s1 |
| InChIKey | IGTIYKQPKYDTEW-SCSAIBSYSA-N |
| XLogP | 0.41 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.12 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |