C6H11N5O — CID 130598575
(3R)-3-amino-3-(1-methyltriazol-4-yl)propanamide (PubChem CID 130598575) has the molecular formula C6H11N5O and a molecular weight of 169.19 g/mol. Its IUPAC name is (3R)-3-amino-3-(1-methyltriazol-4-yl)propanamide.
| Compound Name | (3R)-3-amino-3-(1-methyltriazol-4-yl)propanamide |
|---|---|
| PubChem CID | 130598575 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | (3R)-3-amino-3-(1-methyltriazol-4-yl)propanamide |
| SMILES | Cn1cc([C@H](N)CC(N)=O)nn1 |
| InChI | InChI=1S/C6H11N5O/c1-11-3-5(9-10-11)4(7)2-6(8)12/h3-4H,2,7H2,1H3,(H2,8,12)/t4-/m1/s1 |
| InChIKey | JOHGWBZQWTZOCJ-SCSAIBSYSA-N |
| XLogP | -1.31 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |