C11H12Cl2N4 — CID 112735844
2-(2,5-dichlorophenyl)-1-(1-methyltriazol-4-yl)ethanamine (PubChem CID 112735844) has the molecular formula C11H12Cl2N4 and a molecular weight of 271.15 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-1-(1-methyltriazol-4-yl)ethanamine.
| Compound Name | 2-(2,5-dichlorophenyl)-1-(1-methyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 112735844 |
| Molecular Formula | C11H12Cl2N4 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-1-(1-methyltriazol-4-yl)ethanamine |
| SMILES | Cn1cc(C(N)Cc2cc(Cl)ccc2Cl)nn1 |
| InChI | InChI=1S/C11H12Cl2N4/c1-17-6-11(15-16-17)10(14)5-7-4-8(12)2-3-9(7)13/h2-4,6,10H,5,14H2,1H3 |
| InChIKey | HSNNCLMNGUFGJO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |