C11H15Cl2N — CID 65316880
4-(2,5-dichlorophenyl)-3-methylbutan-2-amine (PubChem CID 65316880) has the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)-3-methylbutan-2-amine.
| Compound Name | 4-(2,5-dichlorophenyl)-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 65316880 |
| Molecular Formula | C11H15Cl2N |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 4-(2,5-dichlorophenyl)-3-methylbutan-2-amine |
| SMILES | CC(N)C(C)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H15Cl2N/c1-7(8(2)14)5-9-6-10(12)3-4-11(9)13/h3-4,6-8H,5,14H2,1-2H3 |
| InChIKey | ONMIKJMXFJZNGA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |