C12H12Cl2 — CID 83931386
1,4-dichloro-2-(2-methylpent-3-ynyl)benzene (PubChem CID 83931386) has the molecular formula C12H12Cl2 and a molecular weight of 227.13 g/mol. Its IUPAC name is 1,4-dichloro-2-(2-methylpent-3-ynyl)benzene.
| Compound Name | 1,4-dichloro-2-(2-methylpent-3-ynyl)benzene |
|---|---|
| PubChem CID | 83931386 |
| Molecular Formula | C12H12Cl2 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 1,4-dichloro-2-(2-methylpent-3-ynyl)benzene |
| SMILES | CC#CC(C)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H12Cl2/c1-3-4-9(2)7-10-8-11(13)5-6-12(10)14/h5-6,8-9H,7H2,1-2H3 |
| InChIKey | MXSNTTZJVPFNCQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|