C11H11Cl2NS — CID 112718520
[3-(2,5-dichlorophenyl)-2-methylpropyl] thiocyanate (PubChem CID 112718520) has the molecular formula C11H11Cl2NS and a molecular weight of 260.19 g/mol. Its IUPAC name is [3-(2,5-dichlorophenyl)-2-methylpropyl] thiocyanate.
| Compound Name | [3-(2,5-dichlorophenyl)-2-methylpropyl] thiocyanate |
|---|---|
| PubChem CID | 112718520 |
| Molecular Formula | C11H11Cl2NS |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | [3-(2,5-dichlorophenyl)-2-methylpropyl] thiocyanate |
| SMILES | CC(CSC#N)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H11Cl2NS/c1-8(6-15-7-14)4-9-5-10(12)2-3-11(9)13/h2-3,5,8H,4,6H2,1H3 |
| InChIKey | WMDFCLLTLXAQCC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|