C15H11Cl2NS — CID 2303123
[(1S)-2-(2,5-dichlorophenyl)-1-phenylethyl] thiocyanate (PubChem CID 2303123) has the molecular formula C15H11Cl2NS and a molecular weight of 308.23 g/mol. Its IUPAC name is [(1S)-2-(2,5-dichlorophenyl)-1-phenylethyl] thiocyanate.
| Compound Name | [(1S)-2-(2,5-dichlorophenyl)-1-phenylethyl] thiocyanate |
|---|---|
| PubChem CID | 2303123 |
| Molecular Formula | C15H11Cl2NS |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | [(1S)-2-(2,5-dichlorophenyl)-1-phenylethyl] thiocyanate |
| SMILES | N#CS[C@@H](Cc1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H11Cl2NS/c16-13-6-7-14(17)12(8-13)9-15(19-10-18)11-4-2-1-3-5-11/h1-8,15H,9H2/t15-/m0/s1 |
| InChIKey | RYKARBNGJVHWIL-HNNXBMFYSA-N |
| XLogP | 5.49 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|