C15H18ClNS — CID 112718573
[3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-2-methylpropyl] thiocyanate (PubChem CID 112718573) has the molecular formula C15H18ClNS and a molecular weight of 279.84 g/mol. Its IUPAC name is [3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-2-methylpropyl] thiocyanate.
| Compound Name | [3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-2-methylpropyl] thiocyanate |
|---|---|
| PubChem CID | 112718573 |
| Molecular Formula | C15H18ClNS |
| Molecular Weight | 279.84 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | [3-(3-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)-2-methylpropyl] thiocyanate |
| SMILES | CC(CSC#N)Cc1cc2c(cc1Cl)CCCC2 |
| InChI | InChI=1S/C15H18ClNS/c1-11(9-18-10-17)6-14-7-12-4-2-3-5-13(12)8-15(14)16/h7-8,11H,2-6,9H2,1H3 |
| InChIKey | BJYCQPDJEJMAJW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|