C13H16ClNO2S — CID 112719666
[3-(5-chloro-2,4-dimethoxyphenyl)-2-methylpropyl] thiocyanate (PubChem CID 112719666) has the molecular formula C13H16ClNO2S and a molecular weight of 285.80 g/mol. Its IUPAC name is [3-(5-chloro-2,4-dimethoxyphenyl)-2-methylpropyl] thiocyanate.
| Compound Name | [3-(5-chloro-2,4-dimethoxyphenyl)-2-methylpropyl] thiocyanate |
|---|---|
| PubChem CID | 112719666 |
| Molecular Formula | C13H16ClNO2S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | [3-(5-chloro-2,4-dimethoxyphenyl)-2-methylpropyl] thiocyanate |
| SMILES | COc1cc(OC)c(CC(C)CSC#N)cc1Cl |
| InChI | InChI=1S/C13H16ClNO2S/c1-9(7-18-8-15)4-10-5-11(14)13(17-3)6-12(10)16-2/h5-6,9H,4,7H2,1-3H3 |
| InChIKey | XMUXPRPZHQRZSW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|