C12H14ClNO2S — CID 112719690
3-(2-chloro-4,5-dimethoxyphenyl)propyl thiocyanate (PubChem CID 112719690) has the molecular formula C12H14ClNO2S and a molecular weight of 271.77 g/mol. Its IUPAC name is 3-(2-chloro-4,5-dimethoxyphenyl)propyl thiocyanate.
| Compound Name | 3-(2-chloro-4,5-dimethoxyphenyl)propyl thiocyanate |
|---|---|
| PubChem CID | 112719690 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 3-(2-chloro-4,5-dimethoxyphenyl)propyl thiocyanate |
| SMILES | COc1cc(Cl)c(CCCSC#N)cc1OC |
| InChI | InChI=1S/C12H14ClNO2S/c1-15-11-6-9(4-3-5-17-8-14)10(13)7-12(11)16-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | BJVMGCFELBJSAW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|