C12H13Cl2NOS — CID 112719473
3-(3,5-dichloro-2-ethoxyphenyl)propyl thiocyanate (PubChem CID 112719473) has the molecular formula C12H13Cl2NOS and a molecular weight of 290.22 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-ethoxyphenyl)propyl thiocyanate.
| Compound Name | 3-(3,5-dichloro-2-ethoxyphenyl)propyl thiocyanate |
|---|---|
| PubChem CID | 112719473 |
| Molecular Formula | C12H13Cl2NOS |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 3-(3,5-dichloro-2-ethoxyphenyl)propyl thiocyanate |
| SMILES | CCOc1c(Cl)cc(Cl)cc1CCCSC#N |
| InChI | InChI=1S/C12H13Cl2NOS/c1-2-16-12-9(4-3-5-17-8-15)6-10(13)7-11(12)14/h6-7H,2-5H2,1H3 |
| InChIKey | XRJWTBMYPOMLCH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|