C14H19NOS — CID 112719350
3-(4-ethoxy-2,3-dimethylphenyl)propyl thiocyanate (PubChem CID 112719350) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-(4-ethoxy-2,3-dimethylphenyl)propyl thiocyanate.
| Compound Name | 3-(4-ethoxy-2,3-dimethylphenyl)propyl thiocyanate |
|---|---|
| PubChem CID | 112719350 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-(4-ethoxy-2,3-dimethylphenyl)propyl thiocyanate |
| SMILES | CCOc1ccc(CCCSC#N)c(C)c1C |
| InChI | InChI=1S/C14H19NOS/c1-4-16-14-8-7-13(11(2)12(14)3)6-5-9-17-10-15/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | HMYGTSBWEISCBK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|